1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulphonic acid, compound with 3-(4-phenyl-1-piperazinyl)propane-1,2-diol (1:1) structure
|
Common Name | 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-propanesulphonic acid, compound with 3-(4-phenyl-1-piperazinyl)propane-1,2-diol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 83742-47-6 | Molecular Weight | 538.61700 | |
| Density | N/A | Boiling Point | 832.2ºC at 760 mmHg | |
| Molecular Formula | C23H34N6O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 457.1ºC | |
| Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propane-1-sulfonic acid,3-(4-phenylpiperazin-1-yl)propane-1,2-diol |
|---|
| Boiling Point | 832.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H34N6O7S |
| Molecular Weight | 538.61700 |
| Flash Point | 457.1ºC |
| Exact Mass | 538.22100 |
| PSA | 171.51000 |
| InChIKey | DCJSSUOXQHSVQL-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCCS(=O)(=O)O)n(C)c1=O.OCC(O)CN1CCN(c2ccccc2)CC1 |