1,1,3,3-tetra(propan-2-yl)urea structure
|
Common Name | 1,1,3,3-tetra(propan-2-yl)urea | ||
|---|---|---|---|---|
| CAS Number | 83756-09-6 | Molecular Weight | 228.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,3,3-tetra(propan-2-yl)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H28N2O |
|---|---|
| Molecular Weight | 228.37400 |
| Exact Mass | 228.22000 |
| PSA | 23.55000 |
| LogP | 3.34400 |
| InChIKey | TUUMZEPFCCXCEJ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)N(C(C)C)C(C)C)C(C)C |
|
~%
1,1,3,3-tetra(p... CAS#:83756-09-6 |
| Literature: Barton, Derek H. R.; Elliott, John D.; Gero, Stephan D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 9 p. 2085 - 2090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N,N',N'-Tetraisopropylurea |