1-(7-methoxy-4-nitro-1-benzofuran-2-yl)ethanone structure
|
Common Name | 1-(7-methoxy-4-nitro-1-benzofuran-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 83767-16-2 | Molecular Weight | 235.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(7-methoxy-4-nitro-1-benzofuran-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9NO5 |
|---|---|
| Molecular Weight | 235.19300 |
| Exact Mass | 235.04800 |
| PSA | 85.26000 |
| LogP | 3.07540 |
| InChIKey | AVPIFKNKZZATNU-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c2cc(C(C)=O)oc12 |
|
~79%
1-(7-methoxy-4-... CAS#:83767-16-2 |
| Literature: Ando, Kumiko; Tsuji, Eriko; Ando, Yuko; Kuwata, Noriko; Kunitomo, Jun-Ichi; Yamashita, Masayuki; Ohta, Shunsaku; Kohno, Shigekatsu; Ohishi, Yoshitaka Organic and Biomolecular Chemistry, 2004 , vol. 2, # 4 p. 625 - 635 |
|
~42%
1-(7-methoxy-4-... CAS#:83767-16-2 |
| Literature: Bachelet, Jean-Pierre; Clavel, Jean-Marc; Demerseman, Pierre; Royer, Rene Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 737 - 739 |
|
~%
1-(7-methoxy-4-... CAS#:83767-16-2 |
| Literature: Ando, Kumiko; Tsuji, Eriko; Ando, Yuko; Kuwata, Noriko; Kunitomo, Jun-Ichi; Yamashita, Masayuki; Ohta, Shunsaku; Kohno, Shigekatsu; Ohishi, Yoshitaka Organic and Biomolecular Chemistry, 2004 , vol. 2, # 4 p. 625 - 635 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-nitro-2-acetyl-7-methoxybenzo<b>furan |
| 2-acetyl-7-methoxy-4-nitrobenzofuran |
| Acetyl-2 methoxy-7 nitro-4 benzofuranne |