5-chloro-1-[(4-chlorophenoxy)methyl]pyrimidin-2-one structure
|
Common Name | 5-chloro-1-[(4-chlorophenoxy)methyl]pyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 83767-91-3 | Molecular Weight | 271.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-1-[(4-chlorophenoxy)methyl]pyrimidin-2-one |
|---|
| Molecular Formula | C11H8Cl2N2O2 |
|---|---|
| Molecular Weight | 271.09900 |
| Exact Mass | 269.99600 |
| PSA | 44.12000 |
| LogP | 2.58660 |
| InChIKey | ZZZPQRYCLOPQMJ-UHFFFAOYSA-N |
| SMILES | O=c1ncc(Cl)cn1COc1ccc(Cl)cc1 |
|
~%
5-chloro-1-[(4-... CAS#:83767-91-3 |
| Literature: Benneche, Tore; Undheim, Kjell Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1983 , vol. 37, # 4 p. 345 - 350 |
|
~27%
5-chloro-1-[(4-... CAS#:83767-91-3 |
| Literature: Benneche, Tore; Undheim, Kjell Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1983 , vol. 37, # 4 p. 345 - 350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |