5-chloro-1-[(4-methylphenoxy)methyl]pyrimidin-2-one structure
|
Common Name | 5-chloro-1-[(4-methylphenoxy)methyl]pyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 83768-06-3 | Molecular Weight | 250.68100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-1-[(4-methylphenoxy)methyl]pyrimidin-2-one |
|---|
| Molecular Formula | C12H11ClN2O2 |
|---|---|
| Molecular Weight | 250.68100 |
| Exact Mass | 250.05100 |
| PSA | 44.12000 |
| LogP | 2.24160 |
| InChIKey | FXBPNDJBRJNCNZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCn2cc(Cl)cnc2=O)cc1 |
|
~%
5-chloro-1-[(4-... CAS#:83768-06-3 |
| Literature: Nyegaard and Co. A.S. Patent: US4596870 A1, 1986 ; |
|
~47%
5-chloro-1-[(4-... CAS#:83768-06-3 |
| Literature: Benneche, Tore; Undheim, Kjell Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1983 , vol. 37, # 4 p. 345 - 350 |
|
~%
5-chloro-1-[(4-... CAS#:83768-06-3 |
| Literature: Benneche, Tore; Undheim, Kjell Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1983 , vol. 37, # 4 p. 345 - 350 |