methyl5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate
Modify Date: 2026-07-14 16:46:44
methyl5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate structure
|
Common Name | methyl5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 83781-71-9 | Molecular Weight | 220.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 333.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5±22.5 °C | |
| Name | Methyl 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.0±42.0 °C at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.264 |
| Flash Point | 137.5±22.5 °C |
| Exact Mass | 220.109940 |
| PSA | 35.53000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | LPVPIHAVUIQSCD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCc2c(cccc2OC)C1 |
| HS Code | 2918990090 |
|---|
![(1R,2S)-methyl [1-hydroxy-5-methoxy-1,2,3,4-tetrahydro-2-naphthyl]formate structure](https://image.chemsrc.com/caspic/217/328553-17-9.png)
![[2-((trimethylsilyl)methyl)-6-methoxybenzyl]dimethylamine structure](https://image.chemsrc.com/caspic/029/83781-46-8.png)
![[2-((trimethylsilyl)methyl)-6-methoxybenzyl]trimethylammonium iodide structure](https://image.chemsrc.com/caspic/405/83781-49-1.png)
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Naphthalenecarboxylic acid, 1,2,3,4-tetrahydro-5-methoxy-, methyl ester |
| methyl 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| Methyl 5-methoxy-1,2,3,4-tetrahydro-2-naphthalenecarboxylate |
| methyl5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |