5-[(3,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione structure
|
Common Name | 5-[(3,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 83797-80-2 | Molecular Weight | 236.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(3,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
|---|
| Molecular Formula | C11H12N2O2S |
|---|---|
| Molecular Weight | 236.29000 |
| Exact Mass | 236.06200 |
| PSA | 86.95000 |
| LogP | 2.55410 |
| InChIKey | CBKNEZFXVCTZCM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(OCc2n[nH]c(=S)o2)c1 |
|
~80%
5-[(3,5-dimethy... CAS#:83797-80-2 |
| Literature: Pathak; Srivastava; Bahel Journal of the Indian Chemical Society, 1982 , vol. 59, # 6 p. 776 - 778 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |