1H-Pyrrole,2,5-diphenyl- structure
|
Common Name | 1H-Pyrrole,2,5-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 838-40-4 | Molecular Weight | 219.28100 | |
| Density | 1.105g/cm3 | Boiling Point | 415.1ºC at 760 mmHg | |
| Molecular Formula | C16H13N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 2,5-diphenyl-1H-pyrrole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 415.1ºC at 760 mmHg |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.28100 |
| Flash Point | 174.5ºC |
| Exact Mass | 219.10500 |
| PSA | 15.79000 |
| LogP | 4.34870 |
| Index of Refraction | 1.622 |
| InChIKey | RJCRXUOYULQDPG-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(-c3ccccc3)[nH]2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-diphenylpyrrole |
| 2,5-diphenyl-1H-pyrrol |
| 2,5-Diphenyl-pyrrol |
| 1H-Pyrrole,2,5-diphenyl |