Disodium 1-O-phosphonato-β-D-glucopyranose structure
|
Common Name | Disodium 1-O-phosphonato-β-D-glucopyranose | ||
|---|---|---|---|---|
| CAS Number | 83833-15-2 | Molecular Weight | 304.099 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11Na2O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Disodium 1-O-phosphonato-β-D-glucopyranoseβ-D-Glucopyranose 1-Phosphate Disodium Salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Disodium 1-O-phosphonato-α-L-gulopyranose |
|---|---|
| Synonym | More Synonyms |
| Description | β-D-Glucopyranose 1-Phosphate Disodium Salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C6H11Na2O9P |
|---|---|
| Molecular Weight | 304.099 |
| Exact Mass | 303.993622 |
| PSA | 172.38000 |
| InChIKey | DCOZWBXYGZXXRX-UZUGEDCSSA-L |
| SMILES | O=P([O-])([O-])OC1OC(CO)C(O)C(O)C1O.[Na+].[Na+] |
| Storage condition | -20°C |
| glucosee 1,6-diphosphate |
| Glucose-1,6-diphosphat |
| glucose 1-phosphate disodium salt |
| Disodium 1-O-phosphonato-β-D-glucopyranose |
| D-glucose-1-phosphate disodium salt |
| 1,6-Di-O-phosphono-D-glucose |
| glucose 1,6-diphosphate |
| Man1,6BP |
| Mannose-1,6-bisphosphate |
| β-D-Glucopyranose, 1-(dihydrogen phosphate), sodium salt (1:2) |
| disodium glucose-1-phosphate |
| D-Mannose 1,6-bisphosphate |