2-(3,4-dichlorophenyl)-2-methoxyacetyl chloride structure
|
Common Name | 2-(3,4-dichlorophenyl)-2-methoxyacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 83833-34-5 | Molecular Weight | 253.51000 | |
| Density | 1.422g/cm3 | Boiling Point | 313.2ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 2-(3,4-dichlorophenyl)-2-methoxyacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 313.2ºC at 760 mmHg |
| Molecular Formula | C9H7Cl3O2 |
| Molecular Weight | 253.51000 |
| Flash Point | 129.9ºC |
| Exact Mass | 251.95100 |
| PSA | 26.30000 |
| LogP | 3.44630 |
| Index of Refraction | 1.55 |
| InChIKey | MPPQGAXHXULEHG-UHFFFAOYSA-N |
| SMILES | COC(C(=O)Cl)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 281-009-9 |
| Benzeneacetyl chloride,3,4-dichloro-a-methoxy |