3-methyl-4-phenyl-1-(p-tolylsulphonyl)piperidine-4-carbonitrile structure
|
Common Name | 3-methyl-4-phenyl-1-(p-tolylsulphonyl)piperidine-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 83863-65-4 | Molecular Weight | 354.46600 | |
| Density | 1.25g/cm3 | Boiling Point | 535.7ºC at 760 mmHg | |
| Molecular Formula | C20H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.8ºC | |
| Name | 3-methyl-1-(4-methylphenyl)sulfonyl-4-phenylpiperidine-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 535.7ºC at 760 mmHg |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.46600 |
| Flash Point | 277.8ºC |
| Exact Mass | 354.14000 |
| PSA | 69.55000 |
| LogP | 4.50578 |
| Index of Refraction | 1.619 |
| InChIKey | XFZXKHZEHPBOOY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C#N)(c3ccccc3)C(C)C2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 281-130-7 |