1,2-Propanediol,1,4-benzenediol,and 3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione polymer structure
|
Common Name | 1,2-Propanediol,1,4-benzenediol,and 3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione polymer | ||
|---|---|---|---|---|
| CAS Number | 83864-25-9 | Molecular Weight | 350.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-Propanediol,1,4-benzenediol,and 3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione polymer |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22O7 |
|---|---|
| Molecular Weight | 350.36300 |
| Exact Mass | 350.13700 |
| PSA | 124.29000 |
| LogP | 0.96540 |
| InChIKey | UKMBWBZBTQHOST-UHFFFAOYSA-N |
| SMILES | CC(O)CO.O=C1OC(=O)C2C3C=CC(C3)C12.Oc1ccc(O)cc1 |
| 4,7-Methanoisobenzofuran-1,3-dione,3a,4,7,7a-tetrahydro-,polymer with 1,4-benzenediol and 1,2-propanediol |