(E)-3-[3,4-dihydroxy-5-(4-prop-2-enylphenoxy)phenyl]prop-2-enal structure
|
Common Name | (E)-3-[3,4-dihydroxy-5-(4-prop-2-enylphenoxy)phenyl]prop-2-enal | ||
|---|---|---|---|---|
| CAS Number | 83864-77-1 | Molecular Weight | 296.31700 | |
| Density | 1.236g/cm3 | Boiling Point | 472ºC at 760 mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | (E)-3-[3,4-dihydroxy-5-(4-prop-2-enylphenoxy)phenyl]prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760 mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 171.5ºC |
| Exact Mass | 296.10500 |
| PSA | 66.76000 |
| LogP | 3.83070 |
| Index of Refraction | 1.641 |
| InChIKey | KGHJODCHEIEYBP-HWKANZROSA-N |
| SMILES | C=CCc1ccc(Oc2cc(C=CC=O)cc(O)c2O)cc1 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Obovatal |