Methyl3-fluoro-5-hydroxy-4-methoxybenzoate structure
|
Common Name | Methyl3-fluoro-5-hydroxy-4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 838856-88-5 | Molecular Weight | 200.164 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 331.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5±27.9 °C | |
| Name | Methyl 3-fluoro-5-hydroxy-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.9±42.0 °C at 760 mmHg |
| Molecular Formula | C9H9FO4 |
| Molecular Weight | 200.164 |
| Flash Point | 154.5±27.9 °C |
| Exact Mass | 200.048492 |
| PSA | 55.76000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | UNMSFZXTTMKBRY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c(OC)c(F)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Methyl3-fluoro-... CAS#:838856-88-5 |
| Literature: SANOFI-AVENTIS; PERNERSTORFER, Josef; KLEEMANN, Heinz-Werner; SCHAEFER, Matthias; SAFAROVA, Alena; PATEK, Marcel Patent: WO2011/53948 A1, 2011 ; Location in patent: Page/Page column 142-143 ; WO 2011/053948 A1 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 3-fluoro-5-hydroxy-4-methoxybenzoate |
| 3-Fluoro-4-nitrobenzoic acid methyl ester |
| methyl 3-fluoro-5-hydroxy-4-(methyloxy)benzoate |
| Benzoic acid, 3-fluoro-5-hydroxy-4-methoxy-, methyl ester |
| 3-fluoro-5-hydroxy-4-methoxybenzoic acid methyl ester |
| Methyl 3-Fluoro-4-nitrobenzenecarboxylate |
| Methyl3-fluoro-5-hydroxy-4-methoxybenzoate |