norfluoxetine hydrochloride structure
|
Common Name | norfluoxetine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 83891-03-6 | Molecular Weight | 331.760 | |
| Density | 1.204g/cm3 | Boiling Point | 381.1ºC at 760 mmHg | |
| Molecular Formula | C16H17ClF3NO | Melting Point | 105-108ºC | |
| MSDS | Chinese | Flash Point | 184.3ºC | |
| Name | norfluoxetine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 381.1ºC at 760 mmHg |
| Melting Point | 105-108ºC |
| Molecular Formula | C16H17ClF3NO |
| Molecular Weight | 331.760 |
| Flash Point | 184.3ºC |
| Exact Mass | 331.095062 |
| PSA | 35.25000 |
| LogP | 5.67660 |
| Index of Refraction | 1.525 |
| InChIKey | WIQRCHMSJFFONW-UHFFFAOYSA-N |
| SMILES | NCCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922299090 |
|
~%
norfluoxetine h... CAS#:83891-03-6 |
| Literature: Eli Lilly and Company Patent: US4313896 A1, 1982 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-desmethylfluoxetine |
| Benzenepropanamine, γ-(4-(trifluoromethyl)phenoxy)-, hydrochloride |
| NORFLUOXETINE HCL |
| 3-Phenyl-3-[4-(trifluoromethyl)phenoxy]-1-propanamine hydrochloride (1:1) |
| Benzenepropanamine, γ-[4-(trifluoromethyl)phenoxy]-, hydrochloride (1:1) |