3-hydroxy-4-[(naphthalen-2-ylamino)methylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 3-hydroxy-4-[(naphthalen-2-ylamino)methylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 83919-59-9 | Molecular Weight | 263.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-4-[(naphthalen-2-ylamino)methylidene]cyclohexa-2,5-dien-1-one |
|---|
| Molecular Formula | C17H13NO2 |
|---|---|
| Molecular Weight | 263.29100 |
| Exact Mass | 263.09500 |
| PSA | 49.33000 |
| LogP | 3.78940 |
| InChIKey | HNJMUNLPLGCOQZ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C=Nc2ccc3ccccc3c2)c(O)c1 |
|
~%
3-hydroxy-4-[(n... CAS#:83919-59-9 |
| Literature: Senier; Gallagher Journal of the Chemical Society, 1918 , vol. 113, p. 32 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |