1-[[3-(Ethylamino)propyl]amino]-5,6,11-trimethyl-6H-pyrido[4,3-b]carbazol-9-ol structure
|
Common Name | 1-[[3-(Ethylamino)propyl]amino]-5,6,11-trimethyl-6H-pyrido[4,3-b]carbazol-9-ol | ||
|---|---|---|---|---|
| CAS Number | 83948-22-5 | Molecular Weight | 376.49500 | |
| Density | 1.22g/cm3 | Boiling Point | 639.2ºC at 760mmHg | |
| Molecular Formula | C23H28N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.4ºC | |
| Name | 1-[3-(ethylamino)propylamino]-5,6,11-trimethylpyrido[4,3-b]carbazol-9-ol |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 639.2ºC at 760mmHg |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.49500 |
| Flash Point | 340.4ºC |
| Exact Mass | 376.22600 |
| PSA | 62.11000 |
| LogP | 5.07750 |
| Index of Refraction | 1.646 |
| InChIKey | IIKWVXMURNUUFB-UHFFFAOYSA-N |
| SMILES | CCNCCCNc1nccc2c(C)c3c(c(C)c12)c1cc(O)ccc1n3C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |