5-HEPE structure
|
Common Name | 5-HEPE | ||
|---|---|---|---|---|
| CAS Number | 83952-40-3 | Molecular Weight | 318.450 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 488.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±25.2 °C | |
Use of 5-HEPE(±)5-HEPE is produced by non-enzymatic oxidation of EPA. |
| Name | 5-hepe |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.0±45.0 °C at 760 mmHg |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.450 |
| Flash Point | 263.1±25.2 °C |
| Exact Mass | 318.219482 |
| PSA | 57.53000 |
| LogP | 4.88 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | FTAGQROYQYQRHF-FCWZHQICSA-N |
| SMILES | CCC=CCC=CCC=CCC=CC=CC(O)CCCC(=O)O |
| HS Code | 2918199090 |
|---|
|
~87%
5-HEPE CAS#:83952-40-3 |
| Literature: Kuklev, Dmitry V.; Smith, William L. Chemistry and Physics of Lipids, 2004 , vol. 130, # 2 p. 145 - 158 |
|
~%
5-HEPE CAS#:83952-40-3 |
| Literature: Kuklev, Dmitry V.; Smith, William L. Chemistry and Physics of Lipids, 2004 , vol. 130, # 2 p. 145 - 158 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (5S,6E,8Z,11Z,14Z,17Z)-5-Hydroxy-6,8,11,14,17-icosapentaenoic acid |
| 6,8,11,14,17-Eicosapentaenoic acid, 5-hydroxy-, (5S,6E,8Z,11Z,14Z,17Z)- |
| 5-hydroxy-6,8,11,14,17-eicosapentaenoic acid |
| 5-HEPE |
| 5-hydroxy,6E,8Z,11Z,14Z,17Z-eicosapentaenoic acid |