2-di-n-propylamino-5,8-dimethoxytetralin structure
|
Common Name | 2-di-n-propylamino-5,8-dimethoxytetralin | ||
|---|---|---|---|---|
| CAS Number | 83964-59-4 | Molecular Weight | 291.42800 | |
| Density | 1.01g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C18H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.5ºC | |
| Name | 5,8-dimethoxy-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.42800 |
| Flash Point | 137.5ºC |
| Exact Mass | 291.22000 |
| PSA | 21.70000 |
| LogP | 3.68310 |
| Index of Refraction | 1.524 |
| InChIKey | OGYDMHQMRVUGRF-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C1CCc2c(OC)ccc(OC)c2C1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Jmc 181 |
| 2-Di-n-propylamino-5,8-dimethoxytetralin |
| 2-Naphthalenamine,1,2,3,4-tetrahydro-5,8-dimethoxy-N,N-dipropyl |