FMOC-3,3-DIPHENYL-DL-ALANINE structure
|
Common Name | FMOC-3,3-DIPHENYL-DL-ALANINE | ||
|---|---|---|---|---|
| CAS Number | 839719-72-1 | Molecular Weight | 463.524 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 676.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.9±31.5 °C | |
| Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β-phenylphenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 676.5±55.0 °C at 760 mmHg |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.524 |
| Flash Point | 362.9±31.5 °C |
| Exact Mass | 463.178345 |
| PSA | 79.12000 |
| LogP | 7.22 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | PENQOTJCVODUQU-UHFFFAOYSA-N |
| SMILES | O=C(NC(C(=O)O)C(c1ccccc1)c1ccccc1)OCC1c2ccccc2-c2ccccc21 |
|
~10%
FMOC-3,3-DIPHEN... CAS#:839719-72-1 |
| Literature: Jorgensen, Malene R.; Olsen, Christian A.; Mellor, Ian R.; Usherwood, Peter N. R.; Witt, Matthias; Franzyk, Henrik; Jaroszewski, Jerzy W. Journal of Medicinal Chemistry, 2005 , vol. 48, # 1 p. 56 - 70 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β-phenylphenylalanine |
| Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-β-phenyl- |