pipamazine structure
|
Common Name | pipamazine | ||
|---|---|---|---|---|
| CAS Number | 84-04-8 | Molecular Weight | 401.95300 | |
| Density | 1.277g/cm3 | Boiling Point | 626.6ºC at 760 mmHg | |
| Molecular Formula | C21H24ClN3OS | Melting Point | about 139° | |
| MSDS | N/A | Flash Point | 332.8ºC | |
| Name | 1-[3-(2-chlorophenothiazin-10-yl)propyl]piperidine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 626.6ºC at 760 mmHg |
| Melting Point | about 139° |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.95300 |
| Flash Point | 332.8ºC |
| Exact Mass | 401.13300 |
| PSA | 75.86000 |
| LogP | 5.68270 |
| Index of Refraction | 1.634 |
| InChIKey | OSJJYEUEJRVVOD-UHFFFAOYSA-N |
| SMILES | NC(=O)C1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| HS Code | 2934300000 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Mometine |
| Mornidine |
| Nometine |
| EINECS 201-512-9 |
| PIPAMAZINE |
| Nausidol |