Thiopropazate structure
|
Common Name | Thiopropazate | ||
|---|---|---|---|---|
| CAS Number | 84-06-0 | Molecular Weight | 446.00500 | |
| Density | 1.234g/cm3 | Boiling Point | 584.6ºC at 760 mmHg | |
| Molecular Formula | C23H28ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.3ºC | |
Use of ThiopropazateThiopropazate is a typical antipsychotic of the phenothiazine class. It is a prodrug to Perphenazine. Perphenazine is a typical antipsychotic drug. |
| Name | thiopropazate |
|---|---|
| Synonym | More Synonyms |
| Description | Thiopropazate is a typical antipsychotic of the phenothiazine class. It is a prodrug to Perphenazine. Perphenazine is a typical antipsychotic drug. |
|---|---|
| Related Catalog |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 584.6ºC at 760 mmHg |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.00500 |
| Flash Point | 307.3ºC |
| Exact Mass | 445.15900 |
| PSA | 61.32000 |
| LogP | 4.45430 |
| Index of Refraction | 1.6 |
| InChIKey | AIUHRQHVWSUTGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| Tiopropazato |
| Thiopropazatum |
| 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethyl acetate |
| Thiopropazate |
| Dartal |
| Dartalan |
| Perphenazine acetate |
| Thiopropazat |
| Thioperpazat |