[2-methyl-4-[4-(3-methyl-4-propanoyloxy-phenyl)hexan-3-yl]phenyl] propanoate
![[2-methyl-4-[4-(3-methyl-4-propanoyloxy-phenyl)hexan-3-yl]phenyl] propanoate Structure](https://image.chemsrc.com/caspic/103/84-13-9.png)
[2-methyl-4-[4-(3-methyl-4-propanoyloxy-phenyl)hexan-3-yl]phenyl] propanoate structure
|
Common Name | [2-methyl-4-[4-(3-methyl-4-propanoyloxy-phenyl)hexan-3-yl]phenyl] propanoate | ||
|---|---|---|---|---|
| CAS Number | 84-13-9 | Molecular Weight | 410.54600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H34O4 |
|---|---|
| Molecular Weight | 410.54600 |
| Exact Mass | 410.24600 |
| PSA | 52.60000 |
| LogP | 6.62160 |
| InChIKey | ORHVFDBDWJTZIN-UHFFFAOYSA-N |
| SMILES | CCC(=O)Oc1ccc(C(CC)C(CC)c2ccc(OC(=O)CC)c(C)c2)cc1C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:130-73-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Opt.-inakt. 3,4-Bis-(4-propionyloxy-3-methyl-phenyl)-hexan |
| opt.-inakt. 3,4-Bis-(3-methyl-4-propionyloxy-phenyl)-hexan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane have? |
| A: English synonyms of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane: Opt.-inakt. 3,4-Bis-(4-propionyloxy-3-methyl-phenyl)-hexan, opt.-inakt. 3,4-Bis-(3-methyl-4-propionyloxy-phenyl)-hexan. |
| Q: What is the polar surface area (PSA) of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: Polar surface area (PSA) of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is 52.60000. |
| Q: What is the InChIKey of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: InChIKey of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is ORHVFDBDWJTZIN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 84-13-9? |
| A: Chinese name of 84-13-9 is 84-13-9. |
| Q: What are the downstream products of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: Related downstream products(CAS) of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane: 130-73-4. |
| Q: What is the LogP of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: LogP of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is 6.62160. |
| Q: What is the molecular weight of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: Molecular weight of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is 410.54600. |
| Q: What is the CAS number of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: CAS number of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is 84-13-9. |
| Q: What is the English name of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: The English name of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane. |
| Q: What is the SMILES notation of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane? |
| A: SMILES notation of optically inactive 3,4-bis-(4-propionyloxy-3-methyl-phenyl)-hexane is CCC(=O)Oc1ccc(C(CC)C(CC)c2ccc(OC(=O)CC)c(C)c2)cc1C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |