2,2-diphenylpentanoic acid structure
|
Common Name | 2,2-diphenylpentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 841-32-7 | Molecular Weight | 254.32400 | |
| Density | 1.104g/cm3 | Boiling Point | 332.7ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | 154-156ºC | |
| MSDS | N/A | Flash Point | 169.2ºC | |
| Name | 2,2-diphenylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 332.7ºC at 760 mmHg |
| Melting Point | 154-156ºC |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 169.2ºC |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.85740 |
| Index of Refraction | 1.566 |
| InChIKey | IVYXLCYENQNVHM-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)O)(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1.1-Diphenyl-butan-carbonsaeure-(1) |
| SKF 2314 |
| Valeric acid,2,2-diphenyl |
| 2,2-DIMETHYL-5-NITRO-2H-BENZIMIDAZOLE TRIHYDRATE |
| Valeric acid,2-diphenyl |
| Propyl-diphenyl-essigsaeure |
| 2,2-Diphenyl-valeriansaeure |
| 2,2-diphenyl-valeric acid |
| Diphenylpropylacetic acid |