5-CYANOBENZOFURAN-2-CARBOXYLIC ACID
5-CYANOBENZOFURAN-2-CARBOXYLIC ACID structure
|
Common Name | 5-CYANOBENZOFURAN-2-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 84102-75-0 | Molecular Weight | 187.15200 | |
| Density | 1.47 | Boiling Point | N/A | |
| Molecular Formula | C10H5NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5-cyano-1-benzofuran-2-carboxylic acid (Chinese name: 5-氰基-2-苯并[b]呋喃甲酸), CAS number: 84102-75-0, molecular formula: C10H5NO3, molecular weight: 187.15200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-cyano-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.47 |
|---|---|
| Molecular Formula | C10H5NO3 |
| Molecular Weight | 187.15200 |
| Exact Mass | 187.02700 |
| PSA | 74.23000 |
| LogP | 2.00268 |
| InChIKey | UJQXZANNFIHPGV-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2oc(C(=O)O)cc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 3 | |
CAS#:84102-83-0
CAS#:84102-98-7![5-(4,5-dihydro-1H-imidazol-2-yl)-N-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1-benzofuran-2-carboxamide,hydrochloride structure](https://image.chemsrc.com/caspic/281/84102-99-8.png)
CAS#:84102-99-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Cyano-2-benzo[b]furancarboxylic acid |
| 5-cyano-2-benzofurancarboxylic acid |
| 5-cyanobenzofuran-2-carboxylic Acid |
| 5-cyanobenzofuran-2-carboxylate |
| 5-cyanobenzo[b]furan-2-carboxylic acid |
| 2-Benzofurancarboxylic acid,5-cyano |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: Related downstream products(CAS) of 5-cyano-1-benzofuran-2-carboxylic acid: 84102-83-0;84102-98-7;84102-99-8. |
| Q: What are the upstream materials of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: Related upstream materials(CAS) of 5-cyano-1-benzofuran-2-carboxylic acid: 80531-14-2;84102-77-2;26028-36-4;24581-99-5;1761-61-1;38220-75-6. |
| Q: What is the SMILES notation of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: SMILES notation of 5-cyano-1-benzofuran-2-carboxylic acid is N#Cc1ccc2oc(C(=O)O)cc2c1. |
| Q: What is the polar surface area (PSA) of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: Polar surface area (PSA) of 5-cyano-1-benzofuran-2-carboxylic acid is 74.23000. |
| Q: What is the InChIKey of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: InChIKey of 5-cyano-1-benzofuran-2-carboxylic acid is UJQXZANNFIHPGV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: Molecular weight of 5-cyano-1-benzofuran-2-carboxylic acid is 187.15200. |
| Q: What is the English name of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: The English name of 5-cyano-1-benzofuran-2-carboxylic acid is 5-cyano-1-benzofuran-2-carboxylic acid. |
| Q: What is the CAS number of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: CAS number of 5-cyano-1-benzofuran-2-carboxylic acid is 84102-75-0. |
| Q: What English synonyms does 5-cyano-1-benzofuran-2-carboxylic acid have? |
| A: English synonyms of 5-cyano-1-benzofuran-2-carboxylic acid: 5-Cyano-2-benzo[b]furancarboxylic acid, 5-cyano-2-benzofurancarboxylic acid, 5-cyanobenzofuran-2-carboxylic Acid, 5-cyanobenzofuran-2-carboxylate, 5-cyanobenzo[b]furan-2-carboxylic acid, 2-Benzofurancarboxylic acid,5-cyano. |
| Q: What is the LogP of 5-cyano-1-benzofuran-2-carboxylic acid? |
| A: LogP of 5-cyano-1-benzofuran-2-carboxylic acid is 2.00268. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |