2-(4-methoxyphenyl)sulfonyl-1,3,5-trimethyl-benzene structure
|
Common Name | 2-(4-methoxyphenyl)sulfonyl-1,3,5-trimethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 84113-59-7 | Molecular Weight | 290.37700 | |
| Density | 1.158g/cm3 | Boiling Point | 448.7ºC at 760 mmHg | |
| Molecular Formula | C16H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 2-(4-methoxyphenyl)sulfonyl-1,3,5-trimethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 448.7ºC at 760 mmHg |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.37700 |
| Flash Point | 225.1ºC |
| Exact Mass | 290.09800 |
| PSA | 51.75000 |
| LogP | 4.53400 |
| Index of Refraction | 1.555 |
| InChIKey | UZRRYQWSKNLAJW-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
|
~86%
2-(4-methoxyphe... CAS#:84113-59-7 |
| Literature: Chen, Haijun; Tsalkova, Tamara; Chepurny, Oleg G.; Mei, Fang C.; Holz, George G.; Cheng, Xiaodong; Zhou, Jia Journal of Medicinal Chemistry, 2013 , vol. 56, # 3 p. 952 - 962 |
|
~%
2-(4-methoxyphe... CAS#:84113-59-7 |
| Literature: Truce,W.E.; Guy,M.M. Journal of Organic Chemistry, 1961 , vol. 26, p. 4331 - 4336 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-Methoxyphenyl-mesitylsulfon |
| <4'-Methoxy-phenyl>-<2,4,6-trimethyl-phenyl>-sulfon |
| Mesityl 4-methoxyphenyl sulfone |
| 2-(4-methoxy-benzenesulfonyl)-1,3,5-trimethyl-benzene |
| (4-Methoxy-phenyl)-mesityl-sulfon |