methyl 4-cyano-3-methyl-4-(phenylamino)piperidine-1-carboxylate structure
|
Common Name | methyl 4-cyano-3-methyl-4-(phenylamino)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 84145-24-4 | Molecular Weight | 273.33000 | |
| Density | 1.18g/cm3 | Boiling Point | 450.9ºC at 760 mmHg | |
| Molecular Formula | C15H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | methyl 4-anilino-4-cyano-3-methylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760 mmHg |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.33000 |
| Flash Point | 226.5ºC |
| Exact Mass | 273.14800 |
| PSA | 65.36000 |
| LogP | 2.47998 |
| Index of Refraction | 1.568 |
| InChIKey | AOEIBPYCEZZLSX-UHFFFAOYSA-N |
| SMILES | COC(=O)N1CCC(C#N)(Nc2ccccc2)C(C)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-anilino-4-cyano-3-methyl-piperidine-1-carboxylic acid methyl ester |
| methyl 4-anilino-4-cyano-3-pipecoline-1-carboxylate |
| 4-Anilino-3-cyano-3-pipecolin-1-carbonsaeuremethylester |
| EINECS 282-249-7 |