3-[(4-fluoro-2-nitrophenyl)amino]propanol structure
|
Common Name | 3-[(4-fluoro-2-nitrophenyl)amino]propanol | ||
|---|---|---|---|---|
| CAS Number | 84145-69-7 | Molecular Weight | 214.19400 | |
| Density | 1.377g/cm3 | Boiling Point | 396.6ºC at 760 mmHg | |
| Molecular Formula | C9H11FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.7ºC | |
| Name | 3-(4-fluoro-2-nitroanilino)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 396.6ºC at 760 mmHg |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.19400 |
| Flash Point | 193.7ºC |
| Exact Mass | 214.07500 |
| PSA | 78.08000 |
| LogP | 2.12440 |
| Index of Refraction | 1.6 |
| InChIKey | BUEQGTVYXFOTHO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCCCO |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 282-297-9 |