5-methyl-1H-benzotriazole, compound with morpholine structure
|
Common Name | 5-methyl-1H-benzotriazole, compound with morpholine | ||
|---|---|---|---|---|
| CAS Number | 84176-60-3 | Molecular Weight | 220.27100 | |
| Density | N/A | Boiling Point | 461ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | 5-methyl-2H-benzotriazole,morpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 461ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.27100 |
| Flash Point | 232.6ºC |
| Exact Mass | 220.13200 |
| PSA | 62.83000 |
| LogP | 1.20130 |
| InChIKey | GBLACWHHPFOKFE-UHFFFAOYSA-N |
| SMILES | C1COCCN1.Cc1ccc2n[nH]nc2c1 |
| EINECS 282-327-0 |
| 5-Methyl-1H-benzotriazole,compound with morpholine |