4-methylbenzenesulfonic acid,2-(2-prop-2-enoxyethoxy)ethanol structure
|
Common Name | 4-methylbenzenesulfonic acid,2-(2-prop-2-enoxyethoxy)ethanol | ||
|---|---|---|---|---|
| CAS Number | 84183-96-0 | Molecular Weight | 318.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methylbenzenesulfonic acid,2-(2-prop-2-enoxyethoxy)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22O6S |
|---|---|
| Molecular Weight | 318.38600 |
| Exact Mass | 318.11400 |
| PSA | 101.44000 |
| LogP | 2.52040 |
| InChIKey | UMFDFXHCUFMSCZ-UHFFFAOYSA-N |
| SMILES | C=CCOCCOCCO.Cc1ccc(S(=O)(=O)O)cc1 |
|
~99%
4-methylbenzene... CAS#:84183-96-0 |
| Literature: Denness, James E.; Parker, David; Hubbard, Hugh St. V. A. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1994 , # 7 p. 1445 - 1454 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| allyl diethylene glycol toluene-p-sulfonate |