diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate
diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate structure
|
Common Name | diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate | ||
|---|---|---|---|---|
| CAS Number | 84184-61-2 | Molecular Weight | 270.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O5 |
|---|---|
| Molecular Weight | 270.32100 |
| Exact Mass | 270.14700 |
| PSA | 69.67000 |
| LogP | 1.90020 |
| InChIKey | DHMOVMINAVUPEP-UHFFFAOYSA-N |
| SMILES | C=C(C(=O)OCC)C(C)C(C)(C(C)=O)C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
diethyl 2-acety... CAS#:84184-61-2 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Emslie, Neville D.; Kaye, Perry T.; Mann, R. Leigh Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2293 - 2295 |
|
~55%
diethyl 2-acety... CAS#:84184-61-2 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Houston-McMillan, Mark S.; Kaye, Perry T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1143 - 1146 |
|
~36%
diethyl 2-acety... CAS#:84184-61-2 |
| Literature: Ameer, Farouk; Drewes, Siegfried E.; Houston-McMillan, Mark S.; Kaye, Perry T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1143 - 1146 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diethyl 3,4-dimethyl-5-oxohex-1-ene-2,4-dicarboxylate |
| Pentanedioic acid,2-acetyl-2,3-dimethyl-4-methylene-,diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate have? |
| A: English synonyms of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate: diethyl 3,4-dimethyl-5-oxohex-1-ene-2,4-dicarboxylate, Pentanedioic acid,2-acetyl-2,3-dimethyl-4-methylene-,diethyl ester. |
| Q: What is the English name of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: The English name of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate. |
| Q: What is the molecular formula of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: Molecular formula of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is C14H22O5. |
| Q: What is the Chinese name of 84184-61-2? |
| A: Chinese name of 84184-61-2 is 84184-61-2. |
| Q: What is the molecular weight of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: Molecular weight of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is 270.32100. |
| Q: What is the LogP of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: LogP of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is 1.90020. |
| Q: What are the upstream materials of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: Related upstream materials(CAS) of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate: 609-14-3;62097-05-6. |
| Q: What is the CAS number of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: CAS number of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is 84184-61-2. |
| Q: What is the polar surface area (PSA) of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: Polar surface area (PSA) of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is 69.67000. |
| Q: What is the InChIKey of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate? |
| A: InChIKey of diethyl 2-acetyl-2,3-dimethyl-4-methylidenepentanedioate is DHMOVMINAVUPEP-UHFFFAOYSA-N. |