3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl--D-glucopyranose
3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl--D-glucopyranose structure
|
Common Name | 3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl--D-glucopyranose | ||
|---|---|---|---|---|
| CAS Number | 84207-46-5 | Molecular Weight | 400.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl--D-glucopyranose, CAS号84207-46-5, molecular formula C17H20O9S, molecular weight 400.40000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20O9S |
|---|---|
| Molecular Weight | 400.40000 |
| Exact Mass | 400.08300 |
| PSA | 122.81000 |
| LogP | 1.76820 |
| InChIKey | JYMOPIWZWABELF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C2COC(O2)C(OS(=O)(=O)c2ccc(C)cc2)C1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3868-03-9
CAS#:3868-05-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| di-O-acetyl-1,5-anhydro-2-deoxy-Dg-threo-pent-1-enitol |
| 3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl-β-D-glucopyranose |
| 3,4-DI-O-ACETYL-1,6-ANHYDRO-2-O-P-TOLUENESULFONYL-SS-D-GLUCOPYRANOSE |
| 3,4-Di-O-acetyl-d-arabinal |
| di-O-acetyl D-xylal |
| 3,4-di-O-acetyl-1.5-anhydro-2-deoxy-D-threo-pent-1-enitol |
| 3,4-Di-O-acetyl-1,6-anhydro-2-O-p-toluenesulfonyl-Beta-D-glucopyranose |
| (3R,4S)-3,4-dihydro-2H-pyran-3,4-diyl diacetate |
| 3,4-DI-O-ACETYL-1,6-ANHYDRO-2-O-P-TOLUENESULFONYL-B-D-GLUCOPYRANOSE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: Molecular formula of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is C17H20O9S. |
| Q: What is the polar surface area (PSA) of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: Polar surface area (PSA) of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is 122.81000. |
| Q: What is the LogP of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: LogP of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is 1.76820. |
| Q: What is the molecular weight of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: Molecular weight of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is 400.40000. |
| Q: What is the CAS number of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: CAS number of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is 84207-46-5. |
| Q: What is the Chinese name of 84207-46-5? |
| A: Chinese name of 84207-46-5 is 84207-46-5. |
| Q: What are the downstream products of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: Related downstream products(CAS) of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name): 3868-03-9;3868-05-1. |
| Q: What is the InChIKey of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: InChIKey of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is JYMOPIWZWABELF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: SMILES notation of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is CC(=O)OC1C2COC(O2)C(OS(=O)(=O)c2ccc(C)cc2)C1OC(C)=O. |
| Q: What is the English name of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name)? |
| A: The English name of 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name) is 4-{[(4-Methylphenyl)sulfonyl]oxy}-6,8-dioxabicyclo[3.2.1]octane-2 ,3-diyl diacetate (non-preferred name). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |