6-fluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)-4-oxo-1,8-naphth yridine-3-carboxylic acid structure
|
Common Name | 6-fluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)-4-oxo-1,8-naphth yridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84209-33-6 | Molecular Weight | 352.33600 | |
| Density | 1.403g/cm3 | Boiling Point | 557.7ºC at 760 mmHg | |
| Molecular Formula | C16H18F2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 6-fluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 557.7ºC at 760 mmHg |
| Molecular Formula | C16H18F2N4O3 |
| Molecular Weight | 352.33600 |
| Flash Point | 291.1ºC |
| Exact Mass | 352.13500 |
| PSA | 78.67000 |
| LogP | 0.95800 |
| Index of Refraction | 1.582 |
| InChIKey | FQXWRYWIELRCDO-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3CCF)CC1 |
|
~85%
6-fluoro-1-(2-f... CAS#:84209-33-6 |
| Literature: Matsumoto; Miyamoto; Minamida; Nishimura; Egawa Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 292 - 301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |