N-succinyldesferrioxamine B structure
|
Common Name | N-succinyldesferrioxamine B | ||
|---|---|---|---|---|
| CAS Number | 84211-47-2 | Molecular Weight | 660.75700 | |
| Density | 1.257g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C29H52N6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[5-[[4-[5-[[4-[5-[acetyl(hydroxy)amino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Molecular Formula | C29H52N6O11 |
| Molecular Weight | 660.75700 |
| Exact Mass | 660.36900 |
| PSA | 256.69000 |
| LogP | 3.46530 |
| Index of Refraction | 1.539 |
| InChIKey | CPEIGBDIJPZAEK-UHFFFAOYSA-N |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)O |
|
~%
N-succinyldesfe... CAS#:84211-47-2 |
| Literature: Ihnat, Peter M.; Vennerstrom, Jonathan L.; Robinson, Dennis H. Journal of Pharmaceutical Sciences, 2000 , vol. 89, # 12 p. 1525 - 1536 |
|
~%
N-succinyldesfe... CAS#:84211-47-2 |
| Literature: Adapa, Srinivas; Huber, Peter; Keller-Schierlein, Walter Helvetica Chimica Acta, 1982 , vol. 65, # 6 p. 1818 - 1824 |
|
~%
N-succinyldesfe... CAS#:84211-47-2 |
| Literature: Bickel,H. et al. Helvetica Chimica Acta, 1963 , vol. 46, p. 1385 - 1389 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Succinyldesferrioxamine B |
| succinamide deferoxamine |
| N-Succinyl-desferri-ferrioxyamin B |
| N-Sdfb |
| 3,14,25-trihydroxy-2,10,13,21,24,32-hexaoxo-3,9,14,20,25,31-hexaazapentatriacontan-35-oicacid |
| HMS3098I12 |