2,6-ditert-butyl-4-(5-phenyl-1H-imidazol-4-yl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(5-phenyl-1H-imidazol-4-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 84217-78-7 | Molecular Weight | 348.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(5-phenyl-1H-imidazol-4-yl)phenol |
|---|
| Molecular Formula | C23H28N2O |
|---|---|
| Molecular Weight | 348.48100 |
| Exact Mass | 348.22000 |
| PSA | 48.91000 |
| LogP | 6.04430 |
| InChIKey | LBIIBXZXQOHHLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(-c2nc[nH]c2-c2ccccc2)cc(C(C)(C)C)c1O |
|
~43%
2,6-ditert-buty... CAS#:84217-78-7 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84217-78-7 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84217-78-7 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |