2,6-ditert-butyl-4-(2-methylsulfanyl-5-phenyl-1,3-thiazol-4-yl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(2-methylsulfanyl-5-phenyl-1,3-thiazol-4-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 84217-80-1 | Molecular Weight | 411.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(2-methylsulfanyl-5-phenyl-1,3-thiazol-4-yl)phenol |
|---|
| Molecular Formula | C24H29NOS2 |
|---|---|
| Molecular Weight | 411.62300 |
| Exact Mass | 411.16900 |
| PSA | 86.66000 |
| LogP | 7.49960 |
| InChIKey | MOLBOLKFXJSFKZ-UHFFFAOYSA-N |
| SMILES | CSc1nc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(-c2ccccc2)s1 |
|
~66%
2,6-ditert-buty... CAS#:84217-80-1 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
|
~%
2,6-ditert-buty... CAS#:84217-80-1 |
| Literature: Isomura; Sakamoto; Ito; Homma; Abe; Kubo Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 152 - 165 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |