(S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene
(S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene structure
|
Common Name | (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 84237-05-8 | Molecular Weight | 246.38800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26O |
|---|---|
| Molecular Weight | 246.38800 |
| Exact Mass | 246.19800 |
| PSA | 9.23000 |
| LogP | 4.97580 |
| InChIKey | ITLMKEZZDGLMPC-INIZCTEOSA-N |
| SMILES | CC(C)=CCCC(C)CCOCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:7540-51-4
CAS#:59614-85-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| citronellyl benzyl ether |
| (3S)-1-(benzyloxy)-3,7-dimethyloct-6-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: Molecular formula of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is C17H26O. |
| Q: What is the molecular weight of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: Molecular weight of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is 246.38800. |
| Q: What is the Chinese name of 84237-05-8? |
| A: Chinese name of 84237-05-8 is 84237-05-8. |
| Q: What is the polar surface area (PSA) of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: Polar surface area (PSA) of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is 9.23000. |
| Q: What is the SMILES notation of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: SMILES notation of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is CC(C)=CCCC(C)CCOCc1ccccc1. |
| Q: What English synonyms does (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene have? |
| A: English synonyms of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene: citronellyl benzyl ether, (3S)-1-(benzyloxy)-3,7-dimethyloct-6-ene. |
| Q: What is the English name of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: The English name of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene. |
| Q: What is the InChIKey of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: InChIKey of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is ITLMKEZZDGLMPC-INIZCTEOSA-N. |
| Q: What is the LogP of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: LogP of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is 4.97580. |
| Q: What is the CAS number of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene? |
| A: CAS number of (S)-((3,7-dimethyloct-6-enyloxy)methyl)benzene is 84237-05-8. |