3',4'-dimethoxy-2-(isopropylamino)butyrophenone structure
|
Common Name | 3',4'-dimethoxy-2-(isopropylamino)butyrophenone | ||
|---|---|---|---|---|
| CAS Number | 84254-91-1 | Molecular Weight | 265.34800 | |
| Density | 1.016g/cm3 | Boiling Point | 377.5ºC at 760 mmHg | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-2-(propan-2-ylamino)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016g/cm3 |
|---|---|
| Boiling Point | 377.5ºC at 760 mmHg |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.34800 |
| Flash Point | 182.1ºC |
| Exact Mass | 265.16800 |
| PSA | 47.56000 |
| LogP | 3.05400 |
| Index of Refraction | 1.496 |
| InChIKey | GFERGFJYQBZYHH-UHFFFAOYSA-N |
| SMILES | CCC(NC(C)C)C(=O)c1ccc(OC)c(OC)c1 |
| HS Code | 2922509090 |
|---|
|
~%
3',4'-dimethoxy... CAS#:84254-91-1 |
| Literature: Schulz,H. Pharmazie, 1967 , vol. 22, p. 19 - 22 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 282-537-2 |