4-Piperidinecarbonitrile,4-[(3-chlorophenyl)amino]-1-(phenylmethyl) structure
|
Common Name | 4-Piperidinecarbonitrile,4-[(3-chlorophenyl)amino]-1-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 84254-99-9 | Molecular Weight | 325.83500 | |
| Density | 1.22g/cm3 | Boiling Point | 502.6ºC at 760 mmHg | |
| Molecular Formula | C19H20ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 1-benzyl-4-(3-chloroanilino)piperidine-4-carbonitrile |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 502.6ºC at 760 mmHg |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.83500 |
| Flash Point | 257.8ºC |
| Exact Mass | 325.13500 |
| PSA | 39.06000 |
| LogP | 4.32118 |
| Index of Refraction | 1.628 |
| InChIKey | RSJDUDFFVNFZPH-UHFFFAOYSA-N |
| SMILES | N#CC1(Nc2cccc(Cl)c2)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |