1-benzhydryl-4-[(4-methoxy-3-nitrophenyl)methyl]piperazine structure
|
Common Name | 1-benzhydryl-4-[(4-methoxy-3-nitrophenyl)methyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 84255-06-1 | Molecular Weight | 417.50000 | |
| Density | 1.21g/cm3 | Boiling Point | 556.3ºC at 760 mmHg | |
| Molecular Formula | C25H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | 1-benzhydryl-4-[(4-methoxy-3-nitrophenyl)methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760 mmHg |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.50000 |
| Flash Point | 290.2ºC |
| Exact Mass | 417.20500 |
| PSA | 61.53000 |
| LogP | 4.90960 |
| Index of Refraction | 1.622 |
| InChIKey | GDMKQKMDYSNLQY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1[N+](=O)[O-] |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 282-554-5 |