1,4-Pentanediamine, N(sup 1),N(sup 1)-diethyl-N(sup 4)-(4-methoxy-2-me thyl-6-quinolinyl)- structure
|
Common Name | 1,4-Pentanediamine, N(sup 1),N(sup 1)-diethyl-N(sup 4)-(4-methoxy-2-me thyl-6-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 84264-30-2 | Molecular Weight | 329.48000 | |
| Density | 1.042g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C20H31N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 1-N,1-N-diethyl-4-N-(4-methoxy-2-methylquinolin-6-yl)pentane-1,4-diamine |
|---|
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.48000 |
| Flash Point | 233.4ºC |
| Exact Mass | 329.24700 |
| PSA | 37.39000 |
| LogP | 4.54720 |
| Index of Refraction | 1.572 |
| InChIKey | ZWSRRWUQXCFFCT-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1ccc2nc(C)cc(OC)c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |