Acetic acid,1-(2-phenylethyl)-2-[[(phenylthio)methyl]imino]hydrazide structure
|
Common Name | Acetic acid,1-(2-phenylethyl)-2-[[(phenylthio)methyl]imino]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 84304-09-6 | Molecular Weight | 313.41700 | |
| Density | 1.11g/cm3 | Boiling Point | 433ºC at 760mmHg | |
| Molecular Formula | C17H19N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.7ºC | |
| Name | N-(2-phenylethyl)-N-[(Z)-phenylsulfanylmethyldiazenyl]acetamide |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760mmHg |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.41700 |
| Flash Point | 215.7ºC |
| Exact Mass | 313.12500 |
| PSA | 70.33000 |
| LogP | 4.19460 |
| Index of Refraction | 1.587 |
| InChIKey | BZJQFUGKBPUTNX-UHFFFAOYSA-N |
| SMILES | CC(=O)N(CCc1ccccc1)N=NCSc1ccccc1 |
|
~%
Acetic acid,1-(... CAS#:84304-09-6 |
| Literature: Trost, Barry M.; Pearson, William, H. Journal of the American Chemical Society, 1983 , vol. 105, # 4 p. 1054 - 1056 |