1,3,4-Oxadiazol-2-ol,2,5-dihydro-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-, 2-acetate structure
|
Common Name | 1,3,4-Oxadiazol-2-ol,2,5-dihydro-2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-, 2-acetate | ||
|---|---|---|---|---|
| CAS Number | 84319-51-7 | Molecular Weight | 278.30400 | |
| Density | 1.18g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | [2-[(4-methoxyphenyl)methyl]-5,5-dimethyl-1,3,4-oxadiazol-2-yl] acetate |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.30400 |
| Flash Point | 146.6ºC |
| Exact Mass | 278.12700 |
| PSA | 69.48000 |
| LogP | 1.54430 |
| Index of Refraction | 1.538 |
| InChIKey | KSBMLTGNOGAKFS-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2(OC(C)=O)N=NC(C)(C)O2)cc1 |
|
~41%
1,3,4-Oxadiazol... CAS#:84319-51-7 |
| Literature: Stephanidou-Stephanatou, J.; Lefkopoulou, S. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 705 - 711 |
|
~%
1,3,4-Oxadiazol... CAS#:84319-51-7 |
| Literature: Stephanidou-Stephanatou, J.; Lefkopoulou, S. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 705 - 711 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |