Benzaldehyde,4-(acetyloxy)-2-chloro-5-methoxy- structure
|
Common Name | Benzaldehyde,4-(acetyloxy)-2-chloro-5-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 84333-02-8 | Molecular Weight | 228.62900 | |
| Density | 1.308g/cm3 | Boiling Point | 320.4ºC at 760mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.2ºC | |
| Name | (5-chloro-4-formyl-2-methoxyphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 320.4ºC at 760mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 135.2ºC |
| Exact Mass | 228.01900 |
| PSA | 52.60000 |
| LogP | 2.08640 |
| Index of Refraction | 1.553 |
| InChIKey | PJHJFLMBMQJZSH-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c(Cl)cc1OC(C)=O |
|
~%
Benzaldehyde,4-... CAS#:84333-02-8 |
| Literature: Jayne Journal of the American Chemical Society, 1953 , vol. 75, p. 1742 |
| 4-Acetoxy-2-chlor-5-methoxy-benzaldehyd |
| 6-chlorovanillin acetate |
| 5-chloro-4-formyl-2-methoxyphenyl acetate |
| 4-acetoxy-2-chloro-5-methoxy-benzaldehyde |
| 4-(acetyloxy)-2-chloro-5-methoxy-benzaldehyde |