4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine
Modify Date: 2025-10-12 17:52:53
![4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine Structure](https://www.chemsrc.com/extcaspic/163/84347-76-2.png)
4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine structure
|
Common Name | 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine | ||
|---|---|---|---|---|
| CAS Number | 84347-76-2 | Molecular Weight | 260.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24N2O |
|---|---|
| Molecular Weight | 260.37 |
| InChIKey | WIHNPBIUQFAFGJ-GORDUTHDSA-N |
| SMILES | NCC=CCOc1cccc(CN2CCCCC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: Molecular formula of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is C16H24N2O. |
| Q: What is the molecular weight of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: Molecular weight of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is 260.37. |
| Q: What is the Chinese name of 84347-76-2? |
| A: Chinese name of 84347-76-2 is 84347-76-2. |
| Q: What is the SMILES notation of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: SMILES notation of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is NCC=CCOc1cccc(CN2CCCCC2)c1. |
| Q: What is the CAS number of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: CAS number of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is 84347-76-2. |
| Q: What is the InChIKey of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: InChIKey of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is WIHNPBIUQFAFGJ-GORDUTHDSA-N. |
| Q: What is the English name of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine? |
| A: The English name of 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine is 4-[3-(1-Piperidinomethyl)phenoxy]-(trans) 2-butenylamine. |