9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid
Modify Date: 2025-11-07 00:03:16
9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid structure
|
Common Name | 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 84357-83-5 | Molecular Weight | 384.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H8O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H8O10 |
|---|---|
| Molecular Weight | 384.2 |
| InChIKey | HYHRRLAVUAAZOZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c2c(c1)C(=O)c1c(C(=O)O)cc(C(=O)O)cc1C2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: The English name of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid. |
| Q: What is the molecular weight of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: Molecular weight of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is 384.2. |
| Q: What is the SMILES notation of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: SMILES notation of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is O=C(O)c1cc(C(=O)O)c2c(c1)C(=O)c1c(C(=O)O)cc(C(=O)O)cc1C2=O. |
| Q: What is the CAS number of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: CAS number of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is 84357-83-5. |
| Q: What is the InChIKey of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: InChIKey of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is HYHRRLAVUAAZOZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 84357-83-5? |
| A: Chinese name of 84357-83-5 is 84357-83-5. |
| Q: What is the molecular formula of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid? |
| A: Molecular formula of 9,10-Dioxo-9,10-dihydroanthracene-1,3,5,7-tetracarboxylic acid is C18H8O10. |