4-cycloheptylidene-2-phenyl-1,3-oxazol-5-one structure
|
Common Name | 4-cycloheptylidene-2-phenyl-1,3-oxazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 84381-69-1 | Molecular Weight | 255.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-cycloheptylidene-2-phenyl-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 38.66000 |
| LogP | 3.03390 |
| InChIKey | YZLKMVGJFQNJNX-UHFFFAOYSA-N |
| SMILES | O=C1OC(c2ccccc2)=NC1=C1CCCCCC1 |
|
~%
4-cycloheptylid... CAS#:84381-69-1 |
| Literature: Lawrenz, Dirk; Mohr, Siegfried; Wendlaender, Birgit Journal of the Chemical Society, Chemical Communications, 1984 , # 13 p. 863 - 865 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-cycloheptylidene-2-phenyl-2-oxazolin-5-one |