2-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1H-benzoimidazole structure
|
Common Name | 2-[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]-1H-benzoimidazole | ||
|---|---|---|---|---|
| CAS Number | 84396-05-4 | Molecular Weight | 408.47000 | |
| Density | 1.318g/cm3 | Boiling Point | 649.5ºC at 760 mmHg | |
| Molecular Formula | C22H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.6ºC | |
| Name | 2-[4-(1H-benzimidazol-2-yl)phenoxy]ethyl 4-methylbenzenesulfonate |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 649.5ºC at 760 mmHg |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.47000 |
| Flash Point | 346.6ºC |
| Exact Mass | 408.11400 |
| PSA | 89.66000 |
| LogP | 5.40340 |
| Index of Refraction | 1.64 |
| InChIKey | WXHITEPSFKPLNW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(-c3nc4ccccc4[nH]3)cc2)cc1 |
|
~%
2-[4-[2-(4-meth... CAS#:84396-05-4 |
| Literature: Omar; Habib; Aboulwafa Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 9 p. 991 - 993 |
|
~%
2-[4-[2-(4-meth... CAS#:84396-05-4 |
| Literature: Omar; Habib; Aboulwafa Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 9 p. 991 - 993 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |