1-methyl-3-phenacyl-3H-indol-2-one structure
|
Common Name | 1-methyl-3-phenacyl-3H-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 844-49-5 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-3-phenacyl-3H-indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 37.38000 |
| LogP | 3.08460 |
| InChIKey | UEUCHHHLQVCQMN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(CC(=O)c2ccccc2)c2ccccc21 |
|
~91%
1-methyl-3-phen... CAS#:844-49-5 |
| Literature: Elmorsy, Saad S.; El-Ahl, Abdel-Aziz S.; Soliman, Hanan; Amer, Fathy A. Tetrahedron Letters, 1996 , vol. 37, # 13 p. 2297 - 2298 |
|
~%
1-methyl-3-phen... CAS#:844-49-5 |
| Literature: Lindwall; Maclennan Journal of the American Chemical Society, 1932 , vol. 54, p. 4739,4741 |
|
~%
1-methyl-3-phen... CAS#:844-49-5 |
| Literature: Lindwall; Maclennan Journal of the American Chemical Society, 1932 , vol. 54, p. 4739,4741 |
|
~%
1-methyl-3-phen... CAS#:844-49-5 |
| Literature: Lindwall; Maclennan Journal of the American Chemical Society, 1932 , vol. 54, p. 4739,4741 |
| 1-Methyl-3-phenacyl-2-indolinone |
| 1-methyl-3-phenacyl-indolin-2-one |
| 1-methyl-3-phenacyl-2-oxoindole |
| N-Methyl-3-benzoylmethyl-oxindol |
| 1-Methyl-3-phenacylindolin-2-on |
| 1-Methyl-3-phenacyl-oxindol |