disodium,N-dioxidophosphinothioylcyclohexanamine structure
|
Common Name | disodium,N-dioxidophosphinothioylcyclohexanamine | ||
|---|---|---|---|---|
| CAS Number | 84439-60-1 | Molecular Weight | 239.18300 | |
| Density | N/A | Boiling Point | 354.5ºC at 760 mmHg | |
| Molecular Formula | C6H12NNa2O2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.2ºC | |
| Name | disodium,N-dioxidophosphinothioylcyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 354.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H12NNa2O2PS |
| Molecular Weight | 239.18300 |
| Flash Point | 168.2ºC |
| Exact Mass | 239.01200 |
| PSA | 100.05000 |
| LogP | 3.03570 |
| InChIKey | ATYPFQBKCQJFMQ-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]P([O-])(=S)NC1CCCCC1 |
|
~53%
disodium,N-diox... CAS#:84439-60-1 |
| Literature: Karimova, P. M.; Timofeev, A. I.; Knunyants, I. L. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1982 , vol. 31, # 10 p. 2118 - 2119 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1982 , # 10 p. 2402 - 2403 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cyclohexylphosphoramidothioic acid disodium salt |
| cyclohexylamidothiophosphoric acid disodium salt |
| disodium N-dioxidophosphinothioylcyclohexanamine |
| Phosphoramidothioic acid,cyclohexyl-,disodium salt |